About N-[2-(1λ3-ioda-2,5-diazacyclopenta-1,3-dien-3-yl)ethyl]acetamide
N-[2-(1λ3-ioda-2,5-diazacyclopenta-1,3-dien-3-yl)ethyl]acetamide (PubChem CID 163871385) has the molecular formula C6H10IN3O
and a molecular weight of 267.07 g/mol. Its IUPAC name is N-[2-(1λ3-ioda-2,5-diazacyclopenta-1,3-dien-3-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-(1λ3-ioda-2,5-diazacyclopenta-1,3-dien-3-yl)ethyl]acetamide |
| PubChem CID | 163871385 |
| Molecular Formula | C6H10IN3O |
| Molecular Weight | 267.07 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | N-[2-(1λ3-ioda-2,5-diazacyclopenta-1,3-dien-3-yl)ethyl]acetamide |
| SMILES | CC(=O)NCCC1=CNI=N1 |
| InChI | InChI=1S/C6H10IN3O/c1-5(11)8-3-2-6-4-9-7-10-6/h4H,2-3H2,1H3,(H,8,11)(H,9,10) |
| InChIKey | PLCKQKHHQYBMAJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.07 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(1λ3-ioda-2,5-diazacyclopenta-1,3-dien-3-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1λ3-ioda-2,5-diazacyclopenta-1,3-dien-3-yl)ethyl]acetamide?
The IUPAC name of N-[2-(1λ3-ioda-2,5-diazacyclopenta-1,3-dien-3-yl)ethyl]acetamide (CID 163871385) is N-[2-(1λ3-ioda-2,5-diazacyclopenta-1,3-dien-3-yl)ethyl]acetamide.
What is the SMILES notation for N-[2-(1λ3-ioda-2,5-diazacyclopenta-1,3-dien-3-yl)ethyl]acetamide?
The canonical SMILES for N-[2-(1λ3-ioda-2,5-diazacyclopenta-1,3-dien-3-yl)ethyl]acetamide is CC(=O)NCCC1=CNI=N1.
What is the InChIKey of N-[2-(1λ3-ioda-2,5-diazacyclopenta-1,3-dien-3-yl)ethyl]acetamide?
The InChIKey is PLCKQKHHQYBMAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10IN3O/c1-5(11)8-3-2-6-4-9-7-10-6/h4H,2-3H2,1H3,(H,8,11)(H,9,10).
What are the key properties of N-[2-(1λ3-ioda-2,5-diazacyclopenta-1,3-dien-3-yl)ethyl]acetamide?
N-[2-(1λ3-ioda-2,5-diazacyclopenta-1,3-dien-3-yl)ethyl]acetamide has a molecular weight of 267.07 g/mol, XLogP of 1.03, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1λ3-ioda-2,5-diazacyclopenta-1,3-dien-3-yl)ethyl]acetamide is sourced from PubChem (CID 163871385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).