C15H29NO2S — CID 163871506
N-[(2R)-but-3-en-2-yl]-1-(tert-butylsulfonylmethyl)cyclohexan-1-amine (PubChem CID 163871506) has the molecular formula C15H29NO2S and a molecular weight of 287.47 g/mol. Its IUPAC name is N-[(2R)-but-3-en-2-yl]-1-(tert-butylsulfonylmethyl)cyclohexan-1-amine.
| Compound Name | N-[(2R)-but-3-en-2-yl]-1-(tert-butylsulfonylmethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 163871506 |
| Molecular Formula | C15H29NO2S |
| Molecular Weight | 287.47 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | N-[(2R)-but-3-en-2-yl]-1-(tert-butylsulfonylmethyl)cyclohexan-1-amine |
| SMILES | C=C[C@@H](C)NC1(CS(=O)(=O)C(C)(C)C)CCCCC1 |
| InChI | InChI=1S/C15H29NO2S/c1-6-13(2)16-15(10-8-7-9-11-15)12-19(17,18)14(3,4)5/h6,13,16H,1,7-12H2,2-5H3/t13-/m1/s1 |
| InChIKey | PLFAASKBTYSILO-CYBMUJFWSA-N |
| XLogP | 3.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|