C22H23Cl2F2N5O3S — CID 163871871
(2,4-dichloro-5-fluorophenyl)-[[4-(3-fluoro-2-pyridinyl)-1-(1-methylimidazol-4-yl)sulfonylpiperidin-4-yl]methylamino]methanol (PubChem CID 163871871) has the molecular formula C22H23Cl2F2N5O3S and a molecular weight of 546.43 g/mol. Its IUPAC name is (2,4-dichloro-5-fluorophenyl)-[[4-(3-fluoro-2-pyridinyl)-1-(1-methylimidazol-4-yl)sulfonylpiperidin-4-yl]methylamino]methanol.
| Compound Name | (2,4-dichloro-5-fluorophenyl)-[[4-(3-fluoro-2-pyridinyl)-1-(1-methylimidazol-4-yl)sulfonylpiperidin-4-yl]methylamino]methanol |
|---|---|
| PubChem CID | 163871871 |
| Molecular Formula | C22H23Cl2F2N5O3S |
| Molecular Weight | 546.43 g/mol |
| Exact Mass | 545.09 |
| IUPAC Name | (2,4-dichloro-5-fluorophenyl)-[[4-(3-fluoro-2-pyridinyl)-1-(1-methylimidazol-4-yl)sulfonylpiperidin-4-yl]methylamino]methanol |
| SMILES | Cn1cnc(S(=O)(=O)N2CCC(CNC(O)c3cc(F)c(Cl)cc3Cl)(c3ncccc3F)CC2)c1 |
| InChI | InChI=1S/C22H23Cl2F2N5O3S/c1-30-11-19(29-13-30)35(33,34)31-7-4-22(5-8-31,20-17(25)3-2-6-27-20)12-28-21(32)14-9-18(26)16(24)10-15(14)23/h2-3,6,9-11,13,21,28,32H,4-5,7-8,12H2,1H3 |
| InChIKey | PLMXXJJXLIXJCV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|