About N-[(2Z,4Z)-3-ethylhexa-2,4-dienylidene]-2-methylpropanamide
N-[(2Z,4Z)-3-ethylhexa-2,4-dienylidene]-2-methylpropanamide (PubChem CID 163872501) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is N-[(2Z,4Z)-3-ethylhexa-2,4-dienylidene]-2-methylpropanamide.
Molecular Properties
| Compound Name | N-[(2Z,4Z)-3-ethylhexa-2,4-dienylidene]-2-methylpropanamide |
| PubChem CID | 163872501 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | N-[(2Z,4Z)-3-ethylhexa-2,4-dienylidene]-2-methylpropanamide |
| SMILES | C/C=C\C(=C/C=N/C(=O)C(C)C)CC |
| InChI | InChI=1S/C12H19NO/c1-5-7-11(6-2)8-9-13-12(14)10(3)4/h5,7-10H,6H2,1-4H3/b7-5-,11-8-,13-9+ |
| InChIKey | PMBJPJQKZPQEOS-RJFIILCHSA-N |
| XLogP | 3.15 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2Z,4Z)-3-ethylhexa-2,4-dienylidene]-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2Z,4Z)-3-ethylhexa-2,4-dienylidene]-2-methylpropanamide?
The IUPAC name of N-[(2Z,4Z)-3-ethylhexa-2,4-dienylidene]-2-methylpropanamide (CID 163872501) is N-[(2Z,4Z)-3-ethylhexa-2,4-dienylidene]-2-methylpropanamide.
What is the SMILES notation for N-[(2Z,4Z)-3-ethylhexa-2,4-dienylidene]-2-methylpropanamide?
The canonical SMILES for N-[(2Z,4Z)-3-ethylhexa-2,4-dienylidene]-2-methylpropanamide is C/C=C\C(=C/C=N/C(=O)C(C)C)CC.
What is the InChIKey of N-[(2Z,4Z)-3-ethylhexa-2,4-dienylidene]-2-methylpropanamide?
The InChIKey is PMBJPJQKZPQEOS-RJFIILCHSA-N. The full InChI is InChI=1S/C12H19NO/c1-5-7-11(6-2)8-9-13-12(14)10(3)4/h5,7-10H,6H2,1-4H3/b7-5-,11-8-,13-9+.
What are the key properties of N-[(2Z,4Z)-3-ethylhexa-2,4-dienylidene]-2-methylpropanamide?
N-[(2Z,4Z)-3-ethylhexa-2,4-dienylidene]-2-methylpropanamide has a molecular weight of 193.29 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2Z,4Z)-3-ethylhexa-2,4-dienylidene]-2-methylpropanamide is sourced from PubChem (CID 163872501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).