C23H34F3NO4Si — CID 163872835
benzyl (2R,3R,5R)-5-methyl-2-(triethylsilyloxymethyl)-3-(3,3,3-trifluoro-2-oxopropyl)pyrrolidine-1-carboxylate (PubChem CID 163872835) has the molecular formula C23H34F3NO4Si and a molecular weight of 473.61 g/mol. Its IUPAC name is benzyl (2R,3R,5R)-5-methyl-2-(triethylsilyloxymethyl)-3-(3,3,3-trifluoro-2-oxopropyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,3R,5R)-5-methyl-2-(triethylsilyloxymethyl)-3-(3,3,3-trifluoro-2-oxopropyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 163872835 |
| Molecular Formula | C23H34F3NO4Si |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | benzyl (2R,3R,5R)-5-methyl-2-(triethylsilyloxymethyl)-3-(3,3,3-trifluoro-2-oxopropyl)pyrrolidine-1-carboxylate |
| SMILES | CC[Si](CC)(CC)OC[C@H]1[C@@H](CC(=O)C(F)(F)F)C[C@@H](C)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H34F3NO4Si/c1-5-32(6-2,7-3)31-16-20-19(14-21(28)23(24,25)26)13-17(4)27(20)22(29)30-15-18-11-9-8-10-12-18/h8-12,17,19-20H,5-7,13-16H2,1-4H3/t17-,19-,20+/m1/s1 |
| InChIKey | JVPMRDUBQBOEOM-RLLQIKCJSA-N |
| XLogP | 5.95 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|