C25H30O7 — CID 163872952
4-O-(5-methyl-4-oxohex-5-enyl) 8-O-[2-(2-methylprop-2-enoyloxy)ethyl] tricyclo[5.2.1.02,6]deca-3,8-diene-4,8-dicarboxylate (PubChem CID 163872952) has the molecular formula C25H30O7 and a molecular weight of 442.51 g/mol. Its IUPAC name is 4-O-(5-methyl-4-oxohex-5-enyl) 8-O-[2-(2-methylprop-2-enoyloxy)ethyl] tricyclo[5.2.1.02,6]deca-3,8-diene-4,8-dicarboxylate.
| Compound Name | 4-O-(5-methyl-4-oxohex-5-enyl) 8-O-[2-(2-methylprop-2-enoyloxy)ethyl] tricyclo[5.2.1.02,6]deca-3,8-diene-4,8-dicarboxylate |
|---|---|
| PubChem CID | 163872952 |
| Molecular Formula | C25H30O7 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 4-O-(5-methyl-4-oxohex-5-enyl) 8-O-[2-(2-methylprop-2-enoyloxy)ethyl] tricyclo[5.2.1.02,6]deca-3,8-diene-4,8-dicarboxylate |
| SMILES | C=C(C)C(=O)CCCOC(=O)C1=CC2C3C=C(C(=O)OCCOC(=O)C(=C)C)C(C3)C2C1 |
| InChI | InChI=1S/C25H30O7/c1-14(2)22(26)6-5-7-30-24(28)17-12-18-16-10-20(19(18)13-17)21(11-16)25(29)32-9-8-31-23(27)15(3)4/h11-12,16,18-20H,1,3,5-10,13H2,2,4H3 |
| InChIKey | PMKRZIYEULBFJJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|