About N-[(5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methyl]-N-methylacetamide
N-[(5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methyl]-N-methylacetamide (PubChem CID 163874573) has the molecular formula C12H14ClNOS
and a molecular weight of 255.77 g/mol. Its IUPAC name is N-[(5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methyl]-N-methylacetamide.
Molecular Properties
| Compound Name | N-[(5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methyl]-N-methylacetamide |
| PubChem CID | 163874573 |
| Molecular Formula | C12H14ClNOS |
| Molecular Weight | 255.77 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | N-[(5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)CC1CSc2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H14ClNOS/c1-8(15)14(2)6-9-7-16-12-4-3-10(13)5-11(9)12/h3-5,9H,6-7H2,1-2H3 |
| InChIKey | PNTKLBIASBFPGC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.77 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methyl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methyl]-N-methylacetamide?
The IUPAC name of N-[(5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methyl]-N-methylacetamide (CID 163874573) is N-[(5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methyl]-N-methylacetamide.
What is the SMILES notation for N-[(5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methyl]-N-methylacetamide?
The canonical SMILES for N-[(5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methyl]-N-methylacetamide is CC(=O)N(C)CC1CSc2ccc(Cl)cc21.
What is the InChIKey of N-[(5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methyl]-N-methylacetamide?
The InChIKey is PNTKLBIASBFPGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClNOS/c1-8(15)14(2)6-9-7-16-12-4-3-10(13)5-11(9)12/h3-5,9H,6-7H2,1-2H3.
What are the key properties of N-[(5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methyl]-N-methylacetamide?
N-[(5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methyl]-N-methylacetamide has a molecular weight of 255.77 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methyl]-N-methylacetamide is sourced from PubChem (CID 163874573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).