C13H17N3 — CID 163874947
(2Z,4E)-3-buta-1,3-dien-2-yl-N'-ethenyl-2-(methylideneamino)hexa-2,4-dienimidamide (PubChem CID 163874947) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is (2Z,4E)-3-buta-1,3-dien-2-yl-N'-ethenyl-2-(methylideneamino)hexa-2,4-dienimidamide.
| Compound Name | (2Z,4E)-3-buta-1,3-dien-2-yl-N'-ethenyl-2-(methylideneamino)hexa-2,4-dienimidamide |
|---|---|
| PubChem CID | 163874947 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | (2Z,4E)-3-buta-1,3-dien-2-yl-N'-ethenyl-2-(methylideneamino)hexa-2,4-dienimidamide |
| SMILES | C=C/N=C(N)/C(N=C)=C(\C=C\C)C(=C)C=C |
| InChI | InChI=1S/C13H17N3/c1-6-9-11(10(4)7-2)12(15-5)13(14)16-8-3/h6-9H,2-5H2,1H3,(H2,14,16)/b9-6+,12-11- |
| InChIKey | POBMCWPULIPGCM-SUNUYMGGSA-N |
| XLogP | 2.76 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|