C15H21F6I2N2O3- — CID 163877268
[1-cyclohexyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] 2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)-2-methyliodanuidylpropanoate (PubChem CID 163877268) has the molecular formula C15H21F6I2N2O3- and a molecular weight of 645.14 g/mol. Its IUPAC name is [1-cyclohexyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] 2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)-2-methyliodanuidylpropanoate.
| Compound Name | [1-cyclohexyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] 2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)-2-methyliodanuidylpropanoate |
|---|---|
| PubChem CID | 163877268 |
| Molecular Formula | C15H21F6I2N2O3- |
| Molecular Weight | 645.14 g/mol |
| Exact Mass | 644.96 |
| IUPAC Name | [1-cyclohexyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] 2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)-2-methyliodanuidylpropanoate |
| SMILES | C[I-]C(C)(C(=O)OC(C1CCCCC1)C(O)(C(F)(F)F)C(F)(F)F)C12NI1N2 |
| InChI | InChI=1S/C15H21F6I2N2O3/c1-11(22-2,15-23(24-15)25-15)10(26)28-9(8-6-4-3-5-7-8)12(27,13(16,17)18)14(19,20)21/h8-9,24-25,27H,3-7H2,1-2H3/q-1 |
| InChIKey | PDKFSRAEHGLTLS-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.14 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|