C7H12F3NS — CID 163878814
(2R)-5-propan-2-yl-2-(trifluoromethyl)-1,3-thiazolidine (PubChem CID 163878814) has the molecular formula C7H12F3NS and a molecular weight of 199.24 g/mol. Its IUPAC name is (2R)-5-propan-2-yl-2-(trifluoromethyl)-1,3-thiazolidine.
| Compound Name | (2R)-5-propan-2-yl-2-(trifluoromethyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 163878814 |
| Molecular Formula | C7H12F3NS |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | (2R)-5-propan-2-yl-2-(trifluoromethyl)-1,3-thiazolidine |
| SMILES | CC(C)C1CN[C@@H](C(F)(F)F)S1 |
| InChI | InChI=1S/C7H12F3NS/c1-4(2)5-3-11-6(12-5)7(8,9)10/h4-6,11H,3H2,1-2H3/t5?,6-/m1/s1 |
| InChIKey | PRHNNBVVDCNNGG-PRJDIBJQSA-N |
| XLogP | 2.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |