C18H25BF2O4S — CID 163880807
4-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanyl-2-ethylbutanoic acid (PubChem CID 163880807) has the molecular formula C18H25BF2O4S and a molecular weight of 386.27 g/mol. Its IUPAC name is 4-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanyl-2-ethylbutanoic acid.
| Compound Name | 4-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanyl-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 163880807 |
| Molecular Formula | C18H25BF2O4S |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 4-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanyl-2-ethylbutanoic acid |
| SMILES | CCC(CCSc1c(F)cc(B2OC(C)(C)C(C)(C)O2)cc1F)C(=O)O |
| InChI | InChI=1S/C18H25BF2O4S/c1-6-11(16(22)23)7-8-26-15-13(20)9-12(10-14(15)21)19-24-17(2,3)18(4,5)25-19/h9-11H,6-8H2,1-5H3,(H,22,23) |
| InChIKey | PTANEEBDCCJKIA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|