About methane;1-methoxy-2,3-dimethylbut-2-ene
methane;1-methoxy-2,3-dimethylbut-2-ene (PubChem CID 163880887) has the molecular formula C10H26O
and a molecular weight of 162.32 g/mol. Its IUPAC name is methane;1-methoxy-2,3-dimethylbut-2-ene.
Molecular Properties
| Compound Name | methane;1-methoxy-2,3-dimethylbut-2-ene |
| PubChem CID | 163880887 |
| Molecular Formula | C10H26O |
| Molecular Weight | 162.32 g/mol |
| Exact Mass | 162.20 |
| IUPAC Name | methane;1-methoxy-2,3-dimethylbut-2-ene |
| SMILES | C.C.C.COCC(C)=C(C)C |
| InChI | InChI=1S/C7H14O.3CH4/c1-6(2)7(3)5-8-4;;;/h5H2,1-4H3;3*1H4 |
| InChIKey | PTCGRQAHNCZCSG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methane;1-methoxy-2,3-dimethylbut-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-methoxy-2,3-dimethylbut-2-ene?
The IUPAC name of methane;1-methoxy-2,3-dimethylbut-2-ene (CID 163880887) is methane;1-methoxy-2,3-dimethylbut-2-ene.
What is the SMILES notation for methane;1-methoxy-2,3-dimethylbut-2-ene?
The canonical SMILES for methane;1-methoxy-2,3-dimethylbut-2-ene is C.C.C.COCC(C)=C(C)C.
What is the InChIKey of methane;1-methoxy-2,3-dimethylbut-2-ene?
The InChIKey is PTCGRQAHNCZCSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.3CH4/c1-6(2)7(3)5-8-4;;;/h5H2,1-4H3;3*1H4.
What are the key properties of methane;1-methoxy-2,3-dimethylbut-2-ene?
methane;1-methoxy-2,3-dimethylbut-2-ene has a molecular weight of 162.32 g/mol, XLogP of 3.90, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-methoxy-2,3-dimethylbut-2-ene is sourced from PubChem (CID 163880887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).