About ethyl 2-[2-[3,5-bis(methoxymethyl)pyrazol-1-yl]ethyl-[2-(2-methylidenehydrazinyl)ethyl]amino]acetate
ethyl 2-[2-[3,5-bis(methoxymethyl)pyrazol-1-yl]ethyl-[2-(2-methylidenehydrazinyl)ethyl]amino]acetate (PubChem CID 163881177) has the molecular formula C16H29N5O4
and a molecular weight of 355.44 g/mol. Its IUPAC name is ethyl 2-[2-[3,5-bis(methoxymethyl)pyrazol-1-yl]ethyl-[2-(2-methylidenehydrazinyl)ethyl]amino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[2-[3,5-bis(methoxymethyl)pyrazol-1-yl]ethyl-[2-(2-methylidenehydrazinyl)ethyl]amino]acetate |
| PubChem CID | 163881177 |
| Molecular Formula | C16H29N5O4 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | ethyl 2-[2-[3,5-bis(methoxymethyl)pyrazol-1-yl]ethyl-[2-(2-methylidenehydrazinyl)ethyl]amino]acetate |
| SMILES | C=NNCCN(CCn1nc(COC)cc1COC)CC(=O)OCC |
| InChI | InChI=1S/C16H29N5O4/c1-5-25-16(22)11-20(7-6-18-17-2)8-9-21-15(13-24-4)10-14(19-21)12-23-3/h10,18H,2,5-9,11-13H2,1,3-4H3 |
| InChIKey | PTIBXNKLNVURDF-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 90.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[2-[3,5-bis(methoxymethyl)pyrazol-1-yl]ethyl-[2-(2-methylidenehydrazinyl)ethyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-[3,5-bis(methoxymethyl)pyrazol-1-yl]ethyl-[2-(2-methylidenehydrazinyl)ethyl]amino]acetate?
The IUPAC name of ethyl 2-[2-[3,5-bis(methoxymethyl)pyrazol-1-yl]ethyl-[2-(2-methylidenehydrazinyl)ethyl]amino]acetate (CID 163881177) is ethyl 2-[2-[3,5-bis(methoxymethyl)pyrazol-1-yl]ethyl-[2-(2-methylidenehydrazinyl)ethyl]amino]acetate.
What is the SMILES notation for ethyl 2-[2-[3,5-bis(methoxymethyl)pyrazol-1-yl]ethyl-[2-(2-methylidenehydrazinyl)ethyl]amino]acetate?
The canonical SMILES for ethyl 2-[2-[3,5-bis(methoxymethyl)pyrazol-1-yl]ethyl-[2-(2-methylidenehydrazinyl)ethyl]amino]acetate is C=NNCCN(CCn1nc(COC)cc1COC)CC(=O)OCC.
What is the InChIKey of ethyl 2-[2-[3,5-bis(methoxymethyl)pyrazol-1-yl]ethyl-[2-(2-methylidenehydrazinyl)ethyl]amino]acetate?
The InChIKey is PTIBXNKLNVURDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29N5O4/c1-5-25-16(22)11-20(7-6-18-17-2)8-9-21-15(13-24-4)10-14(19-21)12-23-3/h10,18H,2,5-9,11-13H2,1,3-4H3.
What are the key properties of ethyl 2-[2-[3,5-bis(methoxymethyl)pyrazol-1-yl]ethyl-[2-(2-methylidenehydrazinyl)ethyl]amino]acetate?
ethyl 2-[2-[3,5-bis(methoxymethyl)pyrazol-1-yl]ethyl-[2-(2-methylidenehydrazinyl)ethyl]amino]acetate has a molecular weight of 355.44 g/mol, XLogP of 0.25, 14 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-[3,5-bis(methoxymethyl)pyrazol-1-yl]ethyl-[2-(2-methylidenehydrazinyl)ethyl]amino]acetate is sourced from PubChem (CID 163881177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).