C15H27FN2 — CID 163881628
(1E,3S,4E)-1-N-ethyl-7-fluoro-1-N,4-N,3,6-tetramethylcyclonona-1,4-diene-1,4-diamine (PubChem CID 163881628) has the molecular formula C15H27FN2 and a molecular weight of 254.39 g/mol. Its IUPAC name is (1E,3S,4E)-1-N-ethyl-7-fluoro-1-N,4-N,3,6-tetramethylcyclonona-1,4-diene-1,4-diamine.
| Compound Name | (1E,3S,4E)-1-N-ethyl-7-fluoro-1-N,4-N,3,6-tetramethylcyclonona-1,4-diene-1,4-diamine |
|---|---|
| PubChem CID | 163881628 |
| Molecular Formula | C15H27FN2 |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | (1E,3S,4E)-1-N-ethyl-7-fluoro-1-N,4-N,3,6-tetramethylcyclonona-1,4-diene-1,4-diamine |
| SMILES | CCN(C)/C1=C/[C@H](C)/C(NC)=C\C(C)C(F)CC1 |
| InChI | InChI=1S/C15H27FN2/c1-6-18(5)13-7-8-14(16)11(2)10-15(17-4)12(3)9-13/h9-12,14,17H,6-8H2,1-5H3/b13-9+,15-10+/t11?,12-,14?/m0/s1 |
| InChIKey | PTSFORVCYMRFSE-VHQGMYKOSA-N |
| XLogP | 3.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |