C14H19NO — CID 163881823
(2E,4E)-5-[(4-methyl-3,4-dihydro-2H-pyridin-1-yl)methyl]hepta-2,4-dien-6-yn-2-ol (PubChem CID 163881823) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (2E,4E)-5-[(4-methyl-3,4-dihydro-2H-pyridin-1-yl)methyl]hepta-2,4-dien-6-yn-2-ol.
| Compound Name | (2E,4E)-5-[(4-methyl-3,4-dihydro-2H-pyridin-1-yl)methyl]hepta-2,4-dien-6-yn-2-ol |
|---|---|
| PubChem CID | 163881823 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (2E,4E)-5-[(4-methyl-3,4-dihydro-2H-pyridin-1-yl)methyl]hepta-2,4-dien-6-yn-2-ol |
| SMILES | C#C/C(=C\C=C(/C)O)CN1C=CC(C)CC1 |
| InChI | InChI=1S/C14H19NO/c1-4-14(6-5-13(3)16)11-15-9-7-12(2)8-10-15/h1,5-7,9,12,16H,8,10-11H2,2-3H3/b13-5+,14-6+ |
| InChIKey | PTXCJEYYZXUKRO-ACFHMISVSA-N |
| XLogP | 2.86 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|