C6H13NO2 — CID 163883112
(2R,3R)-2,5-dimethylpyrrolidine-3,4-diol (PubChem CID 163883112) has the molecular formula C6H13NO2 and a molecular weight of 131.17 g/mol. Its IUPAC name is (2R,3R)-2,5-dimethylpyrrolidine-3,4-diol.
| Compound Name | (2R,3R)-2,5-dimethylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 163883112 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | (2R,3R)-2,5-dimethylpyrrolidine-3,4-diol |
| SMILES | CC1N[C@H](C)[C@@H](O)C1O |
| InChI | InChI=1S/C6H13NO2/c1-3-5(8)6(9)4(2)7-3/h3-9H,1-2H3/t3-,4?,5-,6?/m1/s1 |
| InChIKey | PUZTXPBQAXFVCF-MNTXREMCSA-N |
| XLogP | -0.91 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |