C14H20N2O5S — CID 163883152
(5S)-2,5-dimethyl-4-[methyl-(2-nitrophenyl)sulfanylamino]oxane-3,5-diol (PubChem CID 163883152) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is (5S)-2,5-dimethyl-4-[methyl-(2-nitrophenyl)sulfanylamino]oxane-3,5-diol.
| Compound Name | (5S)-2,5-dimethyl-4-[methyl-(2-nitrophenyl)sulfanylamino]oxane-3,5-diol |
|---|---|
| PubChem CID | 163883152 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | (5S)-2,5-dimethyl-4-[methyl-(2-nitrophenyl)sulfanylamino]oxane-3,5-diol |
| SMILES | CC1OC[C@@](C)(O)C(N(C)Sc2ccccc2[N+](=O)[O-])C1O |
| InChI | InChI=1S/C14H20N2O5S/c1-9-12(17)13(14(2,18)8-21-9)15(3)22-11-7-5-4-6-10(11)16(19)20/h4-7,9,12-13,17-18H,8H2,1-3H3/t9?,12?,13?,14-/m1/s1 |
| InChIKey | PVASWASZJQUBDO-WENFXBKJSA-N |
| XLogP | 1.43 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|