C26H30IN4O2- — CID 163883246
CID 163883246 (PubChem CID 163883246) has the molecular formula C26H30IN4O2- and a molecular weight of 557.46 g/mol.
| Compound Name | CID 163883246 |
|---|---|
| PubChem CID | 163883246 |
| Molecular Formula | C26H30IN4O2- |
| Molecular Weight | 557.46 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | — |
| SMILES | O=C1c2cc(NC3=CNC[I-]C=C3)ccc2CCN1C[C@H](O)CN1CCc2ccccc2C1 |
| InChI | InChI=1S/C26H30IN4O2/c32-24(16-30-11-8-19-3-1-2-4-21(19)15-30)17-31-12-9-20-5-6-22(13-25(20)26(31)33)29-23-7-10-27-18-28-14-23/h1-7,10,13-14,24,28-29,32H,8-9,11-12,15-18H2/q-1/t24-/m1/s1 |
| InChIKey | MMSYTNJMMPJBQH-XMMPIXPASA-N |
| XLogP | -0.48 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.46 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|