C22H30O5 — CID 163883294
(8S)-5-hydroxy-8-[(2R)-2-[(2R)-2-(2-hydroxyacetyl)oxiran-2-yl]propyl]-4a-methyl-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-one (PubChem CID 163883294) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is (8S)-5-hydroxy-8-[(2R)-2-[(2R)-2-(2-hydroxyacetyl)oxiran-2-yl]propyl]-4a-methyl-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-one.
| Compound Name | (8S)-5-hydroxy-8-[(2R)-2-[(2R)-2-(2-hydroxyacetyl)oxiran-2-yl]propyl]-4a-methyl-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-one |
|---|---|
| PubChem CID | 163883294 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (8S)-5-hydroxy-8-[(2R)-2-[(2R)-2-(2-hydroxyacetyl)oxiran-2-yl]propyl]-4a-methyl-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-one |
| SMILES | C[C@H](C[C@@H]1CCC(O)C2C1CCC1=CC(=O)C=CC12C)[C@]1(C(=O)CO)CO1 |
| InChI | InChI=1S/C22H30O5/c1-13(22(12-27-22)19(26)11-23)9-14-3-6-18(25)20-17(14)5-4-15-10-16(24)7-8-21(15,20)2/h7-8,10,13-14,17-18,20,23,25H,3-6,9,11-12H2,1-2H3/t13-,14+,17?,18?,20?,21?,22+/m1/s1 |
| InChIKey | PVDXMYRBZFZBSC-FJQBDVKFSA-N |
| XLogP | 2.21 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|