C31H27IN2O4 — CID 163883796
6-hydroxy-3-iodo-1-methyl-2-[(2E)-4-methylidene-6-[(4-phenylphenyl)carbamoyl]hepta-2,6-dien-2-yl]indole-5-carboxylic acid (PubChem CID 163883796) has the molecular formula C31H27IN2O4 and a molecular weight of 618.47 g/mol. Its IUPAC name is 6-hydroxy-3-iodo-1-methyl-2-[(2E)-4-methylidene-6-[(4-phenylphenyl)carbamoyl]hepta-2,6-dien-2-yl]indole-5-carboxylic acid.
| Compound Name | 6-hydroxy-3-iodo-1-methyl-2-[(2E)-4-methylidene-6-[(4-phenylphenyl)carbamoyl]hepta-2,6-dien-2-yl]indole-5-carboxylic acid |
|---|---|
| PubChem CID | 163883796 |
| Molecular Formula | C31H27IN2O4 |
| Molecular Weight | 618.47 g/mol |
| Exact Mass | 618.10 |
| IUPAC Name | 6-hydroxy-3-iodo-1-methyl-2-[(2E)-4-methylidene-6-[(4-phenylphenyl)carbamoyl]hepta-2,6-dien-2-yl]indole-5-carboxylic acid |
| SMILES | C=C(/C=C(\C)c1c(I)c2cc(C(=O)O)c(O)cc2n1C)CC(=C)C(=O)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H27IN2O4/c1-18(14-19(2)29-28(32)24-16-25(31(37)38)27(35)17-26(24)34(29)4)15-20(3)30(36)33-23-12-10-22(11-13-23)21-8-6-5-7-9-21/h5-14,16-17,35H,1,3,15H2,2,4H3,(H,33,36)(H,37,38)/b19-14+ |
| InChIKey | SMWXWTICZQSGLT-XMHGGMMESA-N |
| XLogP | 7.40 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.47 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|