About (diethyl-λ4-sulfanylidene)-dihydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]-λ5-phosphane
(diethyl-λ4-sulfanylidene)-dihydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]-λ5-phosphane (PubChem CID 163883982) has the molecular formula C9H13Cl3NO3PS
and a molecular weight of 352.61 g/mol. Its IUPAC name is (diethyl-λ4-sulfanylidene)-dihydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]-λ5-phosphane.
Molecular Properties
| Compound Name | (diethyl-λ4-sulfanylidene)-dihydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]-λ5-phosphane |
| PubChem CID | 163883982 |
| Molecular Formula | C9H13Cl3NO3PS |
| Molecular Weight | 352.61 g/mol |
| Exact Mass | 350.94 |
| IUPAC Name | (diethyl-λ4-sulfanylidene)-dihydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]-λ5-phosphane |
| SMILES | CCS(CC)=P(O)(O)Oc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H13Cl3NO3PS/c1-3-18(4-2)17(14,15)16-9-7(11)5-6(10)8(12)13-9/h5,14-15H,3-4H2,1-2H3 |
| InChIKey | CSFQGABKDPFLEX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.61 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (diethyl-λ4-sulfanylidene)-dihydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (diethyl-λ4-sulfanylidene)-dihydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]-λ5-phosphane?
The IUPAC name of (diethyl-λ4-sulfanylidene)-dihydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]-λ5-phosphane (CID 163883982) is (diethyl-λ4-sulfanylidene)-dihydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]-λ5-phosphane.
What is the SMILES notation for (diethyl-λ4-sulfanylidene)-dihydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]-λ5-phosphane?
The canonical SMILES for (diethyl-λ4-sulfanylidene)-dihydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]-λ5-phosphane is CCS(CC)=P(O)(O)Oc1nc(Cl)c(Cl)cc1Cl.
What is the InChIKey of (diethyl-λ4-sulfanylidene)-dihydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]-λ5-phosphane?
The InChIKey is CSFQGABKDPFLEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13Cl3NO3PS/c1-3-18(4-2)17(14,15)16-9-7(11)5-6(10)8(12)13-9/h5,14-15H,3-4H2,1-2H3.
What are the key properties of (diethyl-λ4-sulfanylidene)-dihydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]-λ5-phosphane?
(diethyl-λ4-sulfanylidene)-dihydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]-λ5-phosphane has a molecular weight of 352.61 g/mol, XLogP of 3.74, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (diethyl-λ4-sulfanylidene)-dihydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]-λ5-phosphane is sourced from PubChem (CID 163883982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).