C24H31N3O4 — CID 163884051
(2S)-N-[(2S)-1-(benzylamino)-3-methyl-1-oxopentan-2-yl]-1-[2-(furan-2-yl)-2-oxoethyl]pyrrolidine-2-carboxamide (PubChem CID 163884051) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-(benzylamino)-3-methyl-1-oxopentan-2-yl]-1-[2-(furan-2-yl)-2-oxoethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-1-(benzylamino)-3-methyl-1-oxopentan-2-yl]-1-[2-(furan-2-yl)-2-oxoethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163884051 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | (2S)-N-[(2S)-1-(benzylamino)-3-methyl-1-oxopentan-2-yl]-1-[2-(furan-2-yl)-2-oxoethyl]pyrrolidine-2-carboxamide |
| SMILES | CCC(C)[C@H](NC(=O)[C@@H]1CCCN1CC(=O)c1ccco1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H31N3O4/c1-3-17(2)22(24(30)25-15-18-9-5-4-6-10-18)26-23(29)19-11-7-13-27(19)16-20(28)21-12-8-14-31-21/h4-6,8-10,12,14,17,19,22H,3,7,11,13,15-16H2,1-2H3,(H,25,30)(H,26,29)/t17?,19-,22-/m0/s1 |
| InChIKey | PVUDRIJSULJFOQ-MWRVEUOJSA-N |
| XLogP | 2.77 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |