C27H27ClFN4O3S+ — CID 163884892
CID 163884892 (PubChem CID 163884892) has the molecular formula C27H27ClFN4O3S+ and a molecular weight of 542.06 g/mol.
| Compound Name | CID 163884892 |
|---|---|
| PubChem CID | 163884892 |
| Molecular Formula | C27H27ClFN4O3S+ |
| Molecular Weight | 542.06 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | — |
| SMILES | C=C(F)/C=C(\C)COc1ccc(Nc2ncnc3ccc(-c4ccn(CC[S+](C)(=O)O)c4)cc23)cc1Cl |
| InChI | InChI=1S/C27H26ClFN4O3S/c1-18(12-19(2)29)16-36-26-7-5-22(14-24(26)28)32-27-23-13-20(4-6-25(23)30-17-31-27)21-8-9-33(15-21)10-11-37(3,34)35/h4-9,12-15,17H,2,10-11,16H2,1,3H3,(H-,30,31,32,34,35)/p+1/b18-12+ |
| InChIKey | PWMMSVGRGZLDNC-LDADJPATSA-O |
| XLogP | 6.91 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.06 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|