C15H22NP — CID 163885336
(3-methylcyclohex-3-en-1-yl)-propan-2-yl-pyridin-2-ylphosphane (PubChem CID 163885336) has the molecular formula C15H22NP and a molecular weight of 247.32 g/mol. Its IUPAC name is (3-methylcyclohex-3-en-1-yl)-propan-2-yl-pyridin-2-ylphosphane.
| Compound Name | (3-methylcyclohex-3-en-1-yl)-propan-2-yl-pyridin-2-ylphosphane |
|---|---|
| PubChem CID | 163885336 |
| Molecular Formula | C15H22NP |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | (3-methylcyclohex-3-en-1-yl)-propan-2-yl-pyridin-2-ylphosphane |
| SMILES | CC1=CCCC(P(c2ccccn2)C(C)C)C1 |
| InChI | InChI=1S/C15H22NP/c1-12(2)17(15-9-4-5-10-16-15)14-8-6-7-13(3)11-14/h4-5,7,9-10,12,14H,6,8,11H2,1-3H3 |
| InChIKey | PWVUSYYZSDVAOU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|