C29H40N8O2 — CID 163885365
(E)-N-[2-[5-[2-[(4-cyanocyclohexa-2,4-dien-1-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-2-oxoethyl]-4-(dimethylamino)-N-ethylbut-2-enamide (PubChem CID 163885365) has the molecular formula C29H40N8O2 and a molecular weight of 532.69 g/mol. Its IUPAC name is (E)-N-[2-[5-[2-[(4-cyanocyclohexa-2,4-dien-1-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-2-oxoethyl]-4-(dimethylamino)-N-ethylbut-2-enamide.
| Compound Name | (E)-N-[2-[5-[2-[(4-cyanocyclohexa-2,4-dien-1-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-2-oxoethyl]-4-(dimethylamino)-N-ethylbut-2-enamide |
|---|---|
| PubChem CID | 163885365 |
| Molecular Formula | C29H40N8O2 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.33 |
| IUPAC Name | (E)-N-[2-[5-[2-[(4-cyanocyclohexa-2,4-dien-1-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-2-oxoethyl]-4-(dimethylamino)-N-ethylbut-2-enamide |
| SMILES | CCCNc1nc(NC2C=CC(C#N)=CC2)ncc1C#CCCCNC(=O)CN(CC)C(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C29H40N8O2/c1-5-17-32-28-24(21-33-29(35-28)34-25-15-13-23(20-30)14-16-25)11-8-7-9-18-31-26(38)22-37(6-2)27(39)12-10-19-36(3)4/h10,12-15,21,25H,5-7,9,16-19,22H2,1-4H3,(H,31,38)(H2,32,33,34,35)/b12-10+ |
| InChIKey | PWWINCNGRJWDRF-ZRDIBKRKSA-N |
| XLogP | 2.70 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|