C30H36NO5P — CID 163885711
4-[[2,6-dimethyl-4-[[(2S,4S)-2-oxo-4-pyridin-3-yl-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]phenyl]methyl]-2-[(E)-3-methylpent-3-en-2-yl]phenol (PubChem CID 163885711) has the molecular formula C30H36NO5P and a molecular weight of 521.59 g/mol. Its IUPAC name is 4-[[2,6-dimethyl-4-[[(2S,4S)-2-oxo-4-pyridin-3-yl-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]phenyl]methyl]-2-[(E)-3-methylpent-3-en-2-yl]phenol.
| Compound Name | 4-[[2,6-dimethyl-4-[[(2S,4S)-2-oxo-4-pyridin-3-yl-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]phenyl]methyl]-2-[(E)-3-methylpent-3-en-2-yl]phenol |
|---|---|
| PubChem CID | 163885711 |
| Molecular Formula | C30H36NO5P |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | 4-[[2,6-dimethyl-4-[[(2S,4S)-2-oxo-4-pyridin-3-yl-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]phenyl]methyl]-2-[(E)-3-methylpent-3-en-2-yl]phenol |
| SMILES | C/C=C(\C)C(C)c1cc(Cc2c(C)cc(OC[P@]3(=O)OCC[C@@H](c4cccnc4)O3)cc2C)ccc1O |
| InChI | InChI=1S/C30H36NO5P/c1-6-20(2)23(5)28-17-24(9-10-29(28)32)16-27-21(3)14-26(15-22(27)4)34-19-37(33)35-13-11-30(36-37)25-8-7-12-31-18-25/h6-10,12,14-15,17-18,23,30,32H,11,13,16,19H2,1-5H3/b20-6+/t23?,30-,37-/m0/s1 |
| InChIKey | PXDFZMQXZKQFSG-VKPRIJJRSA-N |
| XLogP | 7.77 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|