C19H18BrN3O — CID 163886305
N-[5-(3-bromophenyl)-5-phenyl-1,3-diazabicyclo[4.1.0]hept-2-en-2-yl]acetamide (PubChem CID 163886305) has the molecular formula C19H18BrN3O and a molecular weight of 384.28 g/mol. Its IUPAC name is N-[5-(3-bromophenyl)-5-phenyl-1,3-diazabicyclo[4.1.0]hept-2-en-2-yl]acetamide.
| Compound Name | N-[5-(3-bromophenyl)-5-phenyl-1,3-diazabicyclo[4.1.0]hept-2-en-2-yl]acetamide |
|---|---|
| PubChem CID | 163886305 |
| Molecular Formula | C19H18BrN3O |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | N-[5-(3-bromophenyl)-5-phenyl-1,3-diazabicyclo[4.1.0]hept-2-en-2-yl]acetamide |
| SMILES | CC(=O)NC1=NCC(c2ccccc2)(c2cccc(Br)c2)C2CN12 |
| InChI | InChI=1S/C19H18BrN3O/c1-13(24)22-18-21-12-19(17-11-23(17)18,14-6-3-2-4-7-14)15-8-5-9-16(20)10-15/h2-10,17H,11-12H2,1H3,(H,21,22,24) |
| InChIKey | PXPMLVYGIFHUFT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|