About 3,6-dibromo-9-(4-phenylcyclohexa-1,3-dien-1-yl)carbazole
3,6-dibromo-9-(4-phenylcyclohexa-1,3-dien-1-yl)carbazole (PubChem CID 163886610) has the molecular formula C24H17Br2N
and a molecular weight of 479.22 g/mol. Its IUPAC name is 3,6-dibromo-9-(4-phenylcyclohexa-1,3-dien-1-yl)carbazole.
Molecular Properties
| Compound Name | 3,6-dibromo-9-(4-phenylcyclohexa-1,3-dien-1-yl)carbazole |
| PubChem CID | 163886610 |
| Molecular Formula | C24H17Br2N |
| Molecular Weight | 479.22 g/mol |
| Exact Mass | 476.97 |
| IUPAC Name | 3,6-dibromo-9-(4-phenylcyclohexa-1,3-dien-1-yl)carbazole |
| SMILES | Brc1ccc2c(c1)c1cc(Br)ccc1n2C1=CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H17Br2N/c25-18-8-12-23-21(14-18)22-15-19(26)9-13-24(22)27(23)20-10-6-17(7-11-20)16-4-2-1-3-5-16/h1-6,8-10,12-15H,7,11H2 |
| InChIKey | PXWJBDAWGDDYSO-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.22 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,6-dibromo-9-(4-phenylcyclohexa-1,3-dien-1-yl)carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dibromo-9-(4-phenylcyclohexa-1,3-dien-1-yl)carbazole?
The IUPAC name of 3,6-dibromo-9-(4-phenylcyclohexa-1,3-dien-1-yl)carbazole (CID 163886610) is 3,6-dibromo-9-(4-phenylcyclohexa-1,3-dien-1-yl)carbazole.
What is the SMILES notation for 3,6-dibromo-9-(4-phenylcyclohexa-1,3-dien-1-yl)carbazole?
The canonical SMILES for 3,6-dibromo-9-(4-phenylcyclohexa-1,3-dien-1-yl)carbazole is Brc1ccc2c(c1)c1cc(Br)ccc1n2C1=CC=C(c2ccccc2)CC1.
What is the InChIKey of 3,6-dibromo-9-(4-phenylcyclohexa-1,3-dien-1-yl)carbazole?
The InChIKey is PXWJBDAWGDDYSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17Br2N/c25-18-8-12-23-21(14-18)22-15-19(26)9-13-24(22)27(23)20-10-6-17(7-11-20)16-4-2-1-3-5-16/h1-6,8-10,12-15H,7,11H2.
What are the key properties of 3,6-dibromo-9-(4-phenylcyclohexa-1,3-dien-1-yl)carbazole?
3,6-dibromo-9-(4-phenylcyclohexa-1,3-dien-1-yl)carbazole has a molecular weight of 479.22 g/mol, XLogP of 8.04, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dibromo-9-(4-phenylcyclohexa-1,3-dien-1-yl)carbazole is sourced from PubChem (CID 163886610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).