About 1-amino-5-iminopentan-2-one;carbanide;uranium(2+)
1-amino-5-iminopentan-2-one;carbanide;uranium(2+) (PubChem CID 163887646) has the molecular formula C6H12N2OU
and a molecular weight of 366.20 g/mol. Its IUPAC name is 1-amino-5-iminopentan-2-one;carbanide;uranium(2+).
Molecular Properties
| Compound Name | 1-amino-5-iminopentan-2-one;carbanide;uranium(2+) |
| PubChem CID | 163887646 |
| Molecular Formula | C6H12N2OU |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 1-amino-5-iminopentan-2-one;carbanide;uranium(2+) |
| SMILES | [CH3-].[H]/N=[C-]\CCC(=O)CN.[U+2] |
| InChI | InChI=1S/C5H9N2O.CH3.U/c6-3-1-2-5(8)4-7;;/h6H,1-2,4,7H2;1H3;/q2*-1;+2 |
| InChIKey | WKUYZCOOYUMAHF-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-5-iminopentan-2-one;carbanide;uranium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-5-iminopentan-2-one;carbanide;uranium(2+)?
The IUPAC name of 1-amino-5-iminopentan-2-one;carbanide;uranium(2+) (CID 163887646) is 1-amino-5-iminopentan-2-one;carbanide;uranium(2+).
What is the SMILES notation for 1-amino-5-iminopentan-2-one;carbanide;uranium(2+)?
The canonical SMILES for 1-amino-5-iminopentan-2-one;carbanide;uranium(2+) is [CH3-].[H]/N=[C-]\CCC(=O)CN.[U+2].
What is the InChIKey of 1-amino-5-iminopentan-2-one;carbanide;uranium(2+)?
The InChIKey is WKUYZCOOYUMAHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N2O.CH3.U/c6-3-1-2-5(8)4-7;;/h6H,1-2,4,7H2;1H3;/q2*-1;+2.
What are the key properties of 1-amino-5-iminopentan-2-one;carbanide;uranium(2+)?
1-amino-5-iminopentan-2-one;carbanide;uranium(2+) has a molecular weight of 366.20 g/mol, XLogP of 0.27, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-5-iminopentan-2-one;carbanide;uranium(2+) is sourced from PubChem (CID 163887646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).