About (2Z)-2-aminopenta-2,4-dienal
(2Z)-2-aminopenta-2,4-dienal (PubChem CID 163888293) has the molecular formula C5H7NO
and a molecular weight of 97.12 g/mol. Its IUPAC name is (2Z)-2-aminopenta-2,4-dienal.
Molecular Properties
| Compound Name | (2Z)-2-aminopenta-2,4-dienal |
| PubChem CID | 163888293 |
| Molecular Formula | C5H7NO |
| Molecular Weight | 97.12 g/mol |
| Exact Mass | 97.05 |
| IUPAC Name | (2Z)-2-aminopenta-2,4-dienal |
| SMILES | C=C/C=C(\N)C=O |
| InChI | InChI=1S/C5H7NO/c1-2-3-5(6)4-7/h2-4H,1,6H2/b5-3- |
| InChIKey | PZIMIXQTTDHPLA-HYXAFXHYSA-N |
| XLogP | 0.21 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.12 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-aminopenta-2,4-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-aminopenta-2,4-dienal?
The IUPAC name of (2Z)-2-aminopenta-2,4-dienal (CID 163888293) is (2Z)-2-aminopenta-2,4-dienal.
What is the SMILES notation for (2Z)-2-aminopenta-2,4-dienal?
The canonical SMILES for (2Z)-2-aminopenta-2,4-dienal is C=C/C=C(\N)C=O.
What is the InChIKey of (2Z)-2-aminopenta-2,4-dienal?
The InChIKey is PZIMIXQTTDHPLA-HYXAFXHYSA-N. The full InChI is InChI=1S/C5H7NO/c1-2-3-5(6)4-7/h2-4H,1,6H2/b5-3-.
What are the key properties of (2Z)-2-aminopenta-2,4-dienal?
(2Z)-2-aminopenta-2,4-dienal has a molecular weight of 97.12 g/mol, XLogP of 0.21, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-aminopenta-2,4-dienal is sourced from PubChem (CID 163888293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).