C17H29F4N3O4 — CID 163889292
(2S,3R,4R)-3-hydroxy-4-methyl-2-[methyl(3-methylbutanoyl)amino]-6-(2,2,6,6-tetrafluoromorpholin-4-yl)hexanamide (PubChem CID 163889292) has the molecular formula C17H29F4N3O4 and a molecular weight of 415.43 g/mol. Its IUPAC name is (2S,3R,4R)-3-hydroxy-4-methyl-2-[methyl(3-methylbutanoyl)amino]-6-(2,2,6,6-tetrafluoromorpholin-4-yl)hexanamide.
| Compound Name | (2S,3R,4R)-3-hydroxy-4-methyl-2-[methyl(3-methylbutanoyl)amino]-6-(2,2,6,6-tetrafluoromorpholin-4-yl)hexanamide |
|---|---|
| PubChem CID | 163889292 |
| Molecular Formula | C17H29F4N3O4 |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | (2S,3R,4R)-3-hydroxy-4-methyl-2-[methyl(3-methylbutanoyl)amino]-6-(2,2,6,6-tetrafluoromorpholin-4-yl)hexanamide |
| SMILES | CC(C)CC(=O)N(C)C(C(N)=O)[C@H](O)[C@H](C)CCN1CC(F)(F)OC(F)(F)C1 |
| InChI | InChI=1S/C17H29F4N3O4/c1-10(2)7-12(25)23(4)13(15(22)27)14(26)11(3)5-6-24-8-16(18,19)28-17(20,21)9-24/h10-11,13-14,26H,5-9H2,1-4H3,(H2,22,27)/t11-,13?,14-/m1/s1 |
| InChIKey | QAECNEMMQJYIMQ-AODWJNRKSA-N |
| XLogP | 1.25 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |