About CID 163889429
CID 163889429 (PubChem CID 163889429) has the molecular formula C24H25IN4O8P-
and a molecular weight of 655.36 g/mol.
Molecular Properties
| Compound Name | CID 163889429 |
| PubChem CID | 163889429 |
| Molecular Formula | C24H25IN4O8P- |
| Molecular Weight | 655.36 g/mol |
| Exact Mass | 655.05 |
| IUPAC Name | — |
| SMILES | O=C1c2cccc(Oc3cc4c(cc3[N+](=O)[O-])OCCC4OP(=O)(N3CC3)N3C[I-]3)c2CCN1C1COC1 |
| InChI | InChI=1S/C24H25IN4O8P/c30-24-17-2-1-3-20(16(17)4-6-27(24)15-12-34-13-15)36-23-10-18-21(5-9-35-22(18)11-19(23)29(31)32)37-38(33,26-7-8-26)28-14-25-28/h1-3,10-11,15,21H,4-9,12-14H2/q-1 |
| InChIKey | LTOPDSREEICHGS-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 123.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 655.36 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|
Analyze CID 163889429 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163889429?
The IUPAC name of CID 163889429 (CID 163889429) is not available.
What is the SMILES notation for CID 163889429?
The canonical SMILES for CID 163889429 is O=C1c2cccc(Oc3cc4c(cc3[N+](=O)[O-])OCCC4OP(=O)(N3CC3)N3C[I-]3)c2CCN1C1COC1.
What is the InChIKey of CID 163889429?
The InChIKey is LTOPDSREEICHGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25IN4O8P/c30-24-17-2-1-3-20(16(17)4-6-27(24)15-12-34-13-15)36-23-10-18-21(5-9-35-22(18)11-19(23)29(31)32)37-38(33,26-7-8-26)28-14-25-28/h1-3,10-11,15,21H,4-9,12-14H2/q-1.
What are the key properties of CID 163889429?
CID 163889429 has a molecular weight of 655.36 g/mol, XLogP of 0.33, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163889429 is sourced from PubChem (CID 163889429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).