C18H29ClFN3 — CID 163889551
N'-[3-[6-(4-fluoro-5-methylcyclohept-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]butyl]carbamimidoyl chloride (PubChem CID 163889551) has the molecular formula C18H29ClFN3 and a molecular weight of 341.90 g/mol. Its IUPAC name is N'-[3-[6-(4-fluoro-5-methylcyclohept-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]butyl]carbamimidoyl chloride.
| Compound Name | N'-[3-[6-(4-fluoro-5-methylcyclohept-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]butyl]carbamimidoyl chloride |
|---|---|
| PubChem CID | 163889551 |
| Molecular Formula | C18H29ClFN3 |
| Molecular Weight | 341.90 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | N'-[3-[6-(4-fluoro-5-methylcyclohept-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]butyl]carbamimidoyl chloride |
| SMILES | CC(CC/N=C(/N)Cl)C1=CCCNC1C1C=CC(F)C(C)CC1 |
| InChI | InChI=1S/C18H29ClFN3/c1-12(9-11-23-18(19)21)15-4-3-10-22-17(15)14-6-5-13(2)16(20)8-7-14/h4,7-8,12-14,16-17,22H,3,5-6,9-11H2,1-2H3,(H2,21,23) |
| InChIKey | QAJSUUZQMKMDSH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.90 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|