About 1-[5-(trifluoromethyl)-1,2-dihydropyridin-2-yl]piperazine
1-[5-(trifluoromethyl)-1,2-dihydropyridin-2-yl]piperazine (PubChem CID 163889781) has the molecular formula C10H14F3N3
and a molecular weight of 233.24 g/mol. Its IUPAC name is 1-[5-(trifluoromethyl)-1,2-dihydropyridin-2-yl]piperazine.
Molecular Properties
| Compound Name | 1-[5-(trifluoromethyl)-1,2-dihydropyridin-2-yl]piperazine |
| PubChem CID | 163889781 |
| Molecular Formula | C10H14F3N3 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 1-[5-(trifluoromethyl)-1,2-dihydropyridin-2-yl]piperazine |
| SMILES | FC(F)(F)C1=CNC(N2CCNCC2)C=C1 |
| InChI | InChI=1S/C10H14F3N3/c11-10(12,13)8-1-2-9(15-7-8)16-5-3-14-4-6-16/h1-2,7,9,14-15H,3-6H2 |
| InChIKey | QAOGYEJKVYFKDN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[5-(trifluoromethyl)-1,2-dihydropyridin-2-yl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(trifluoromethyl)-1,2-dihydropyridin-2-yl]piperazine?
The IUPAC name of 1-[5-(trifluoromethyl)-1,2-dihydropyridin-2-yl]piperazine (CID 163889781) is 1-[5-(trifluoromethyl)-1,2-dihydropyridin-2-yl]piperazine.
What is the SMILES notation for 1-[5-(trifluoromethyl)-1,2-dihydropyridin-2-yl]piperazine?
The canonical SMILES for 1-[5-(trifluoromethyl)-1,2-dihydropyridin-2-yl]piperazine is FC(F)(F)C1=CNC(N2CCNCC2)C=C1.
What is the InChIKey of 1-[5-(trifluoromethyl)-1,2-dihydropyridin-2-yl]piperazine?
The InChIKey is QAOGYEJKVYFKDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3N3/c11-10(12,13)8-1-2-9(15-7-8)16-5-3-14-4-6-16/h1-2,7,9,14-15H,3-6H2.
What are the key properties of 1-[5-(trifluoromethyl)-1,2-dihydropyridin-2-yl]piperazine?
1-[5-(trifluoromethyl)-1,2-dihydropyridin-2-yl]piperazine has a molecular weight of 233.24 g/mol, XLogP of 0.82, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(trifluoromethyl)-1,2-dihydropyridin-2-yl]piperazine is sourced from PubChem (CID 163889781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).