C9H10FN — CID 163890112
6-fluoro-3-methylocta-3,4,5,7-tetraen-1-imine (PubChem CID 163890112) has the molecular formula C9H10FN and a molecular weight of 151.18 g/mol. Its IUPAC name is 6-fluoro-3-methylocta-3,4,5,7-tetraen-1-imine.
| Compound Name | 6-fluoro-3-methylocta-3,4,5,7-tetraen-1-imine |
|---|---|
| PubChem CID | 163890112 |
| Molecular Formula | C9H10FN |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | 6-fluoro-3-methylocta-3,4,5,7-tetraen-1-imine |
| SMILES | [H]/N=C/CC(C)=C=C=C(F)C=C |
| InChI | InChI=1S/C9H10FN/c1-3-9(10)5-4-8(2)6-7-11/h3,7,11H,1,6H2,2H3/b9-8+,11-7+ |
| InChIKey | QAVCQJYQWNFSSS-WSMCZHAYSA-N |
| XLogP | 2.77 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|