C10H20N2O — CID 163890888
1-(3,4-dimethyl-3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrol-6-yl)-N-methylmethanamine (PubChem CID 163890888) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 1-(3,4-dimethyl-3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrol-6-yl)-N-methylmethanamine.
| Compound Name | 1-(3,4-dimethyl-3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrol-6-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 163890888 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 1-(3,4-dimethyl-3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrol-6-yl)-N-methylmethanamine |
| SMILES | CNCC1NC(C)C2C(C)OCC12 |
| InChI | InChI=1S/C10H20N2O/c1-6-10-7(2)13-5-8(10)9(12-6)4-11-3/h6-12H,4-5H2,1-3H3 |
| InChIKey | QBKZFJJHFCPUTB-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |