C14H12F12O2 — CID 163891050
1,1,1,3,3,3-hexafluoro-2-[[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]hept-5-enyl]methyl]propan-2-ol (PubChem CID 163891050) has the molecular formula C14H12F12O2 and a molecular weight of 440.22 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]hept-5-enyl]methyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]hept-5-enyl]methyl]propan-2-ol |
|---|---|
| PubChem CID | 163891050 |
| Molecular Formula | C14H12F12O2 |
| Molecular Weight | 440.22 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]hept-5-enyl]methyl]propan-2-ol |
| SMILES | OC(CC1C2C=CC(C2)C1C(O)(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H12F12O2/c15-11(16,17)9(27,12(18,19)20)4-7-5-1-2-6(3-5)8(7)10(28,13(21,22)23)14(24,25)26/h1-2,5-8,27-28H,3-4H2 |
| InChIKey | QBOOMYSFWNPDIS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.22 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|