C13H22O2 — CID 163891433
4-(7-hydroxyheptyl)cyclohexa-1,3-dien-1-ol (PubChem CID 163891433) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is 4-(7-hydroxyheptyl)cyclohexa-1,3-dien-1-ol.
| Compound Name | 4-(7-hydroxyheptyl)cyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 163891433 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 4-(7-hydroxyheptyl)cyclohexa-1,3-dien-1-ol |
| SMILES | OCCCCCCCC1=CC=C(O)CC1 |
| InChI | InChI=1S/C13H22O2/c14-11-5-3-1-2-4-6-12-7-9-13(15)10-8-12/h7,9,14-15H,1-6,8,10-11H2 |
| InChIKey | QBWKBUNPJUHTQL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|