C19H23NO3 — CID 163892374
1-[(4a-methyl-5H-naphthalene-2-carbonyl)amino]cyclohexane-1-carboxylic acid (PubChem CID 163892374) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 1-[(4a-methyl-5H-naphthalene-2-carbonyl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[(4a-methyl-5H-naphthalene-2-carbonyl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 163892374 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 1-[(4a-methyl-5H-naphthalene-2-carbonyl)amino]cyclohexane-1-carboxylic acid |
| SMILES | CC12C=CC(C(=O)NC3(C(=O)O)CCCCC3)=CC1=CC=CC2 |
| InChI | InChI=1S/C19H23NO3/c1-18-9-6-3-7-15(18)13-14(8-12-18)16(21)20-19(17(22)23)10-4-2-5-11-19/h3,6-8,12-13H,2,4-5,9-11H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | QCQJENDIRKVKSN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |