C15H18O3 — CID 163892454
11-(3-methyl-2-oxobut-3-enyl)-7-oxatetracyclo[6.2.1.03,5.05,9]undecan-6-one (PubChem CID 163892454) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 11-(3-methyl-2-oxobut-3-enyl)-7-oxatetracyclo[6.2.1.03,5.05,9]undecan-6-one.
| Compound Name | 11-(3-methyl-2-oxobut-3-enyl)-7-oxatetracyclo[6.2.1.03,5.05,9]undecan-6-one |
|---|---|
| PubChem CID | 163892454 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 11-(3-methyl-2-oxobut-3-enyl)-7-oxatetracyclo[6.2.1.03,5.05,9]undecan-6-one |
| SMILES | C=C(C)C(=O)CC1C2CC3CC34C(=O)OC1C4C2 |
| InChI | InChI=1S/C15H18O3/c1-7(2)12(16)5-10-8-3-9-6-15(9)11(4-8)13(10)18-14(15)17/h8-11,13H,1,3-6H2,2H3 |
| InChIKey | QCSHMBCREJZQLN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|