C25H19Cl2N5O5S — CID 163892602
(2S)-2-[[amino-(2,6-dichlorophenyl)methylidene]amino]-3-[4-(1-methyl-6-nitro-4-oxo-2-sulfanylidenequinazolin-3-yl)phenyl]propanoic acid (PubChem CID 163892602) has the molecular formula C25H19Cl2N5O5S and a molecular weight of 572.43 g/mol. Its IUPAC name is (2S)-2-[[amino-(2,6-dichlorophenyl)methylidene]amino]-3-[4-(1-methyl-6-nitro-4-oxo-2-sulfanylidenequinazolin-3-yl)phenyl]propanoic acid.
| Compound Name | (2S)-2-[[amino-(2,6-dichlorophenyl)methylidene]amino]-3-[4-(1-methyl-6-nitro-4-oxo-2-sulfanylidenequinazolin-3-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 163892602 |
| Molecular Formula | C25H19Cl2N5O5S |
| Molecular Weight | 572.43 g/mol |
| Exact Mass | 571.05 |
| IUPAC Name | (2S)-2-[[amino-(2,6-dichlorophenyl)methylidene]amino]-3-[4-(1-methyl-6-nitro-4-oxo-2-sulfanylidenequinazolin-3-yl)phenyl]propanoic acid |
| SMILES | Cn1c(=S)n(-c2ccc(C[C@H](/N=C(\N)c3c(Cl)cccc3Cl)C(=O)O)cc2)c(=O)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C25H19Cl2N5O5S/c1-30-20-10-9-15(32(36)37)12-16(20)23(33)31(25(30)38)14-7-5-13(6-8-14)11-19(24(34)35)29-22(28)21-17(26)3-2-4-18(21)27/h2-10,12,19H,11H2,1H3,(H2,28,29)(H,34,35)/t19-/m0/s1 |
| InChIKey | QCVHRUOEBWZUED-IBGZPJMESA-N |
| XLogP | 4.67 |
| TPSA | 145.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|