About 2-[methyl(methylidene)-λ4-sulfanyl]propyl N-(4-fluorophenyl)carbamate
2-[methyl(methylidene)-λ4-sulfanyl]propyl N-(4-fluorophenyl)carbamate (PubChem CID 163893283) has the molecular formula C12H16FNO2S
and a molecular weight of 257.33 g/mol. Its IUPAC name is 2-[methyl(methylidene)-λ4-sulfanyl]propyl N-(4-fluorophenyl)carbamate.
Molecular Properties
| Compound Name | 2-[methyl(methylidene)-λ4-sulfanyl]propyl N-(4-fluorophenyl)carbamate |
| PubChem CID | 163893283 |
| Molecular Formula | C12H16FNO2S |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 2-[methyl(methylidene)-λ4-sulfanyl]propyl N-(4-fluorophenyl)carbamate |
| SMILES | C=S(C)C(C)COC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C12H16FNO2S/c1-9(17(2)3)8-16-12(15)14-11-6-4-10(13)5-7-11/h4-7,9H,2,8H2,1,3H3,(H,14,15) |
| InChIKey | QDKSJOKOBRAISO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[methyl(methylidene)-λ4-sulfanyl]propyl N-(4-fluorophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl(methylidene)-λ4-sulfanyl]propyl N-(4-fluorophenyl)carbamate?
The IUPAC name of 2-[methyl(methylidene)-λ4-sulfanyl]propyl N-(4-fluorophenyl)carbamate (CID 163893283) is 2-[methyl(methylidene)-λ4-sulfanyl]propyl N-(4-fluorophenyl)carbamate.
What is the SMILES notation for 2-[methyl(methylidene)-λ4-sulfanyl]propyl N-(4-fluorophenyl)carbamate?
The canonical SMILES for 2-[methyl(methylidene)-λ4-sulfanyl]propyl N-(4-fluorophenyl)carbamate is C=S(C)C(C)COC(=O)Nc1ccc(F)cc1.
What is the InChIKey of 2-[methyl(methylidene)-λ4-sulfanyl]propyl N-(4-fluorophenyl)carbamate?
The InChIKey is QDKSJOKOBRAISO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FNO2S/c1-9(17(2)3)8-16-12(15)14-11-6-4-10(13)5-7-11/h4-7,9H,2,8H2,1,3H3,(H,14,15).
What are the key properties of 2-[methyl(methylidene)-λ4-sulfanyl]propyl N-(4-fluorophenyl)carbamate?
2-[methyl(methylidene)-λ4-sulfanyl]propyl N-(4-fluorophenyl)carbamate has a molecular weight of 257.33 g/mol, XLogP of 3.09, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl(methylidene)-λ4-sulfanyl]propyl N-(4-fluorophenyl)carbamate is sourced from PubChem (CID 163893283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).