C13H15F2IN6O2 — CID 163894296
1-[4-[(7-amino-5-methyl-[1,2,5]oxadiazolo[3,4-b]pyridin-6-yl)methyl]piperazin-1-yl]-2,2-difluoro-2-iodoethanone (PubChem CID 163894296) has the molecular formula C13H15F2IN6O2 and a molecular weight of 452.20 g/mol. Its IUPAC name is 1-[4-[(7-amino-5-methyl-[1,2,5]oxadiazolo[3,4-b]pyridin-6-yl)methyl]piperazin-1-yl]-2,2-difluoro-2-iodoethanone.
| Compound Name | 1-[4-[(7-amino-5-methyl-[1,2,5]oxadiazolo[3,4-b]pyridin-6-yl)methyl]piperazin-1-yl]-2,2-difluoro-2-iodoethanone |
|---|---|
| PubChem CID | 163894296 |
| Molecular Formula | C13H15F2IN6O2 |
| Molecular Weight | 452.20 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | 1-[4-[(7-amino-5-methyl-[1,2,5]oxadiazolo[3,4-b]pyridin-6-yl)methyl]piperazin-1-yl]-2,2-difluoro-2-iodoethanone |
| SMILES | Cc1nc2nonc2c(N)c1CN1CCN(C(=O)C(F)(F)I)CC1 |
| InChI | InChI=1S/C13H15F2IN6O2/c1-7-8(9(17)10-11(18-7)20-24-19-10)6-21-2-4-22(5-3-21)12(23)13(14,15)16/h2-6,17H2,1H3 |
| InChIKey | QEFZFFYGDMDMEX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|