C26H29IN2O3S — CID 163894721
(2S)-2-[[4-[[(2R)-2-iodo-3-sulfanylpropyl]amino]-2-naphthalen-1-ylbenzoyl]amino]-4-methylpentanoic acid (PubChem CID 163894721) has the molecular formula C26H29IN2O3S and a molecular weight of 576.50 g/mol. Its IUPAC name is (2S)-2-[[4-[[(2R)-2-iodo-3-sulfanylpropyl]amino]-2-naphthalen-1-ylbenzoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[4-[[(2R)-2-iodo-3-sulfanylpropyl]amino]-2-naphthalen-1-ylbenzoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 163894721 |
| Molecular Formula | C26H29IN2O3S |
| Molecular Weight | 576.50 g/mol |
| Exact Mass | 576.09 |
| IUPAC Name | (2S)-2-[[4-[[(2R)-2-iodo-3-sulfanylpropyl]amino]-2-naphthalen-1-ylbenzoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(NC[C@@H](I)CS)cc1-c1cccc2ccccc12)C(=O)O |
| InChI | InChI=1S/C26H29IN2O3S/c1-16(2)12-24(26(31)32)29-25(30)22-11-10-19(28-14-18(27)15-33)13-23(22)21-9-5-7-17-6-3-4-8-20(17)21/h3-11,13,16,18,24,28,33H,12,14-15H2,1-2H3,(H,29,30)(H,31,32)/t18-,24+/m1/s1 |
| InChIKey | QEPZEKDCNLBEFF-KOSHJBKYSA-N |
| XLogP | 5.88 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.50 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|