C23H25N5O2 — CID 163895651
(2S,3S)-3-naphthalen-1-yl-3-(6-piperidin-1-ylpurin-9-yl)propane-1,2-diol (PubChem CID 163895651) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is (2S,3S)-3-naphthalen-1-yl-3-(6-piperidin-1-ylpurin-9-yl)propane-1,2-diol.
| Compound Name | (2S,3S)-3-naphthalen-1-yl-3-(6-piperidin-1-ylpurin-9-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 163895651 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | (2S,3S)-3-naphthalen-1-yl-3-(6-piperidin-1-ylpurin-9-yl)propane-1,2-diol |
| SMILES | OC[C@@H](O)[C@H](c1cccc2ccccc12)n1cnc2c(N3CCCCC3)ncnc21 |
| InChI | InChI=1S/C23H25N5O2/c29-13-19(30)21(18-10-6-8-16-7-2-3-9-17(16)18)28-15-26-20-22(24-14-25-23(20)28)27-11-4-1-5-12-27/h2-3,6-10,14-15,19,21,29-30H,1,4-5,11-13H2/t19-,21+/m1/s1 |
| InChIKey | QFJBXVZMWQDION-CTNGQTDRSA-N |
| XLogP | 2.91 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |