C14H18BrN3O — CID 163895796
(3S,5R)-N-(6-bromo-3-methyl-2-pyridinyl)-2,5-dimethyl-2-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 163895796) has the molecular formula C14H18BrN3O and a molecular weight of 324.22 g/mol. Its IUPAC name is (3S,5R)-N-(6-bromo-3-methyl-2-pyridinyl)-2,5-dimethyl-2-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | (3S,5R)-N-(6-bromo-3-methyl-2-pyridinyl)-2,5-dimethyl-2-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 163895796 |
| Molecular Formula | C14H18BrN3O |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | (3S,5R)-N-(6-bromo-3-methyl-2-pyridinyl)-2,5-dimethyl-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | Cc1ccc(Br)nc1NC(=O)[C@@H]1C[C@@]2(C)CC2N1C |
| InChI | InChI=1S/C14H18BrN3O/c1-8-4-5-11(15)16-12(8)17-13(19)9-6-14(2)7-10(14)18(9)3/h4-5,9-10H,6-7H2,1-3H3,(H,16,17,19)/t9-,10?,14-/m0/s1 |
| InChIKey | QFMBTJRXXGWQGS-GEPZPADCSA-N |
| XLogP | 2.57 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|