About (4-ethenylphenyl)methyl 6-amino-4-oxo-2,3-dihydro-1H-quinoline-2-carboxylate
(4-ethenylphenyl)methyl 6-amino-4-oxo-2,3-dihydro-1H-quinoline-2-carboxylate (PubChem CID 163896148) has the molecular formula C19H18N2O3
and a molecular weight of 322.36 g/mol. Its IUPAC name is (4-ethenylphenyl)methyl 6-amino-4-oxo-2,3-dihydro-1H-quinoline-2-carboxylate.
Molecular Properties
| Compound Name | (4-ethenylphenyl)methyl 6-amino-4-oxo-2,3-dihydro-1H-quinoline-2-carboxylate |
| PubChem CID | 163896148 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | (4-ethenylphenyl)methyl 6-amino-4-oxo-2,3-dihydro-1H-quinoline-2-carboxylate |
| SMILES | C=Cc1ccc(COC(=O)C2CC(=O)c3cc(N)ccc3N2)cc1 |
| InChI | InChI=1S/C19H18N2O3/c1-2-12-3-5-13(6-4-12)11-24-19(23)17-10-18(22)15-9-14(20)7-8-16(15)21-17/h2-9,17,21H,1,10-11,20H2 |
| InChIKey | QFUCSEBPMNPTHN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4-ethenylphenyl)methyl 6-amino-4-oxo-2,3-dihydro-1H-quinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethenylphenyl)methyl 6-amino-4-oxo-2,3-dihydro-1H-quinoline-2-carboxylate?
The IUPAC name of (4-ethenylphenyl)methyl 6-amino-4-oxo-2,3-dihydro-1H-quinoline-2-carboxylate (CID 163896148) is (4-ethenylphenyl)methyl 6-amino-4-oxo-2,3-dihydro-1H-quinoline-2-carboxylate.
What is the SMILES notation for (4-ethenylphenyl)methyl 6-amino-4-oxo-2,3-dihydro-1H-quinoline-2-carboxylate?
The canonical SMILES for (4-ethenylphenyl)methyl 6-amino-4-oxo-2,3-dihydro-1H-quinoline-2-carboxylate is C=Cc1ccc(COC(=O)C2CC(=O)c3cc(N)ccc3N2)cc1.
What is the InChIKey of (4-ethenylphenyl)methyl 6-amino-4-oxo-2,3-dihydro-1H-quinoline-2-carboxylate?
The InChIKey is QFUCSEBPMNPTHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O3/c1-2-12-3-5-13(6-4-12)11-24-19(23)17-10-18(22)15-9-14(20)7-8-16(15)21-17/h2-9,17,21H,1,10-11,20H2.
What are the key properties of (4-ethenylphenyl)methyl 6-amino-4-oxo-2,3-dihydro-1H-quinoline-2-carboxylate?
(4-ethenylphenyl)methyl 6-amino-4-oxo-2,3-dihydro-1H-quinoline-2-carboxylate has a molecular weight of 322.36 g/mol, XLogP of 3.02, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethenylphenyl)methyl 6-amino-4-oxo-2,3-dihydro-1H-quinoline-2-carboxylate is sourced from PubChem (CID 163896148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).