C68H84N4O4S4 — CID 163897144
2,8-bis[5-(9,9-dihexylfluoren-2-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-5,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodecane (PubChem CID 163897144) has the molecular formula C68H84N4O4S4 and a molecular weight of 1149.71 g/mol. Its IUPAC name is 2,8-bis[5-(9,9-dihexylfluoren-2-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-5,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodecane.
| Compound Name | 2,8-bis[5-(9,9-dihexylfluoren-2-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-5,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodecane |
|---|---|
| PubChem CID | 163897144 |
| Molecular Formula | C68H84N4O4S4 |
| Molecular Weight | 1149.71 g/mol |
| Exact Mass | 1148.54 |
| IUPAC Name | 2,8-bis[5-(9,9-dihexylfluoren-2-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-5,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodecane |
| SMILES | CCCCCCC1(CCCCCC)c2ccccc2-c2ccc(-c3sc(C4C5NSNC5C(c5sc(-c6ccc7c(c6)C(CCCCCC)(CCCCCC)c6ccccc6-7)c6c5OCCO6)C5NSNC54)c4c3OCCO4)cc21 |
| InChI | InChI=1S/C68H84N4O4S4/c1-5-9-13-21-33-67(34-22-14-10-6-2)49-27-19-17-25-45(49)47-31-29-43(41-51(47)67)63-59-61(75-39-37-73-59)65(77-63)53-55-57(71-79-69-55)54(58-56(53)70-80-72-58)66-62-60(74-38-40-76-62)64(78-66)44-30-32-48-46-26-18-20-28-50(46)68(52(48)42-44,35-23-15-11-7-3)36-24-16-12-8-4/h17-20,25-32,41-42,53-58,69-72H,5-16,21-24,33-40H2,1-4H3 |
| InChIKey | IIQWWNKYAHENAI-UHFFFAOYSA-N |
| XLogP | 17.97 |
| TPSA | 85.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1149.71 |
| LogP ≤ 5 | 17.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|