About (3,5-dicarbonochloridoyl-2,6-diiodo-4-methylphenyl)azanium
(3,5-dicarbonochloridoyl-2,6-diiodo-4-methylphenyl)azanium (PubChem CID 163898274) has the molecular formula C9H6Cl2I2NO2+
and a molecular weight of 484.87 g/mol. Its IUPAC name is (3,5-dicarbonochloridoyl-2,6-diiodo-4-methylphenyl)azanium.
Molecular Properties
| Compound Name | (3,5-dicarbonochloridoyl-2,6-diiodo-4-methylphenyl)azanium |
| PubChem CID | 163898274 |
| Molecular Formula | C9H6Cl2I2NO2+ |
| Molecular Weight | 484.87 g/mol |
| Exact Mass | 483.79 |
| IUPAC Name | (3,5-dicarbonochloridoyl-2,6-diiodo-4-methylphenyl)azanium |
| SMILES | Cc1c(C(=O)Cl)c(I)c([NH3+])c(I)c1C(=O)Cl |
| InChI | InChI=1S/C9H5Cl2I2NO2/c1-2-3(8(10)15)5(12)7(14)6(13)4(2)9(11)16/h14H2,1H3/p+1 |
| InChIKey | QHOZIULTOUPADG-UHFFFAOYSA-O |
| XLogP | 2.84 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 484.87 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dicarbonochloridoyl-2,6-diiodo-4-methylphenyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dicarbonochloridoyl-2,6-diiodo-4-methylphenyl)azanium?
The IUPAC name of (3,5-dicarbonochloridoyl-2,6-diiodo-4-methylphenyl)azanium (CID 163898274) is (3,5-dicarbonochloridoyl-2,6-diiodo-4-methylphenyl)azanium.
What is the SMILES notation for (3,5-dicarbonochloridoyl-2,6-diiodo-4-methylphenyl)azanium?
The canonical SMILES for (3,5-dicarbonochloridoyl-2,6-diiodo-4-methylphenyl)azanium is Cc1c(C(=O)Cl)c(I)c([NH3+])c(I)c1C(=O)Cl.
What is the InChIKey of (3,5-dicarbonochloridoyl-2,6-diiodo-4-methylphenyl)azanium?
The InChIKey is QHOZIULTOUPADG-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H5Cl2I2NO2/c1-2-3(8(10)15)5(12)7(14)6(13)4(2)9(11)16/h14H2,1H3/p+1.
What are the key properties of (3,5-dicarbonochloridoyl-2,6-diiodo-4-methylphenyl)azanium?
(3,5-dicarbonochloridoyl-2,6-diiodo-4-methylphenyl)azanium has a molecular weight of 484.87 g/mol, XLogP of 2.84, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dicarbonochloridoyl-2,6-diiodo-4-methylphenyl)azanium is sourced from PubChem (CID 163898274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).