C25H20FNO4S — CID 163898505
N-[2-[5-(7-fluoro-1-benzothiophen-3-yl)-6-oxocyclohexa-1,4-dien-1-yl]-2-oxoethyl]-3-methoxy-4-methylbenzamide (PubChem CID 163898505) has the molecular formula C25H20FNO4S and a molecular weight of 449.50 g/mol. Its IUPAC name is N-[2-[5-(7-fluoro-1-benzothiophen-3-yl)-6-oxocyclohexa-1,4-dien-1-yl]-2-oxoethyl]-3-methoxy-4-methylbenzamide.
| Compound Name | N-[2-[5-(7-fluoro-1-benzothiophen-3-yl)-6-oxocyclohexa-1,4-dien-1-yl]-2-oxoethyl]-3-methoxy-4-methylbenzamide |
|---|---|
| PubChem CID | 163898505 |
| Molecular Formula | C25H20FNO4S |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | N-[2-[5-(7-fluoro-1-benzothiophen-3-yl)-6-oxocyclohexa-1,4-dien-1-yl]-2-oxoethyl]-3-methoxy-4-methylbenzamide |
| SMILES | COc1cc(C(=O)NCC(=O)C2=CCC=C(c3csc4c(F)cccc34)C2=O)ccc1C |
| InChI | InChI=1S/C25H20FNO4S/c1-14-9-10-15(11-22(14)31-2)25(30)27-12-21(28)18-7-3-5-16(23(18)29)19-13-32-24-17(19)6-4-8-20(24)26/h4-11,13H,3,12H2,1-2H3,(H,27,30) |
| InChIKey | QHTUQEXSYQVYLL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|